Templat:Chembox/doc/imagesSetup
| Chembox image ordering |
| row 1 |
ImageFile |
| row 2 |
ImageFile1 |
| row 3 |
ImageFileL1 | ImageFileR1 |
| row 4 |
ImageFileL2 | ImageFileR2 |
| row 5 |
ImageFile2 |
| row 6 |
ImageFile3 |
| row 7 |
ImageFileL3 | ImageFileR3 |
{{Chembox
<!-- Row 1/7 -->
|ImageFile =
|ImageSize =
|ImageAlt =
|ImageCaption =
|ImageName =
<!-- Row 2/7 -->
|ImageFile1 =
|ImageSize1 =
|ImageAlt1 =
|ImageCaption1 =
|ImageName1 =
<!-- Row 3/7 -->
|ImageFileL1 =
|ImageSizeL1 =
|ImageAltL1 =
|ImageCaptionL1 =
|ImageNameL1 =
|ImageFileR1 =
|ImageSizeR1 =
|ImageAltR1 =
|ImageCaptionR1 =
|ImageNameR1 =
|ImageCaptionLR1=
<!-- etc. for Image 2, L2 R2, 3, L3 R3 -->
}}
Basic demo (3 rows, 4 images)
ImageFile: '0', 1, L2 R2
 paramImageCaption |
 image file 1 |
 image file L1 |
 image file R2 |
Caption for pair L2 R2 |
|
| Referensi |
|
|
- Default image size: single = 200px, pair = 100px each
Demo sizes set (basic 3 rows)
demo ImageFile '0', 1, L2 R2
 0: 240px |
 file 1: 150px |
 file L1: 80px |
 file R2: 120px |
Caption for pair L2 R2 |
|
| Referensi |
|
|
Tracking categories (test):
- Default image size: single = 200px, pair = 100px each
Chembox all (10 images, 7 rows)
ImageFilen
 ImageFile<blank> |
 1 |
NameHere L1L1 |
NameHere R1R1 |
double caption LR1 |
 2 |
 L2 |
 R2 |
double caption LR2 |
 3 |
 L3 |
 R3 |
double caption LR3 |
|
| Referensi |
|
|
DDT (hazard images check)
DDT
 |
 |
 |
| Nama |
| Nama IUPAC
1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane |
| Penanda |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| Nomor EC |
|
| KEGG |
|
|
|
| Nomor RTECS |
{{{value}}} |
| UNII |
|
InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H YKey: YVGGHNCTFXOJCH-UHFFFAOYSA-N YInChI=1/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H Key: YVGGHNCTFXOJCH-UHFFFAOYAJ
|
Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
|
| Sifat |
|
C14H9Cl5 |
| Massa molar |
354,48 g·mol−1 |
| Densitas |
0.99 g/cm³[1] |
| Titik lebur |
1.085 °C (1.985 °F; 1.358 K) |
| Titik didih |
260 °C (500 °F; 533 K) |
| Bahaya |
| Bahaya utama |
Toxic, dangerous to the environment |
|
T N |
| Frasa-R |
R25 R40 R48/25 R50/53 |
| Frasa-S |
(S1/2) S22 S36/37 S45 S60 S61 |
| Dosis atau konsentrasi letal (LD, LC): |
|
113 mg/kg (rat) |
|
N verifikasi (apa ini Y N ?) |
| Referensi |
|
|
Tracking categories (test):
CO
Chembox/doc/images
 |
Ball-and-stick model of carbon monoxide |
Spacefill model of carbon monoxide |
|
| Nama |
| Nama IUPAC (preferensi)
|
| Nama lain
Carbon monooxide Carbonous oxide Carbon(II) oxide Carbonyl |
| Penanda |
|
|
|
|
| Referensi Beilstein |
3587264 |
| ChEBI |
|
| ChemSpider |
|
| Nomor EC |
|
| Referensi Gmelin |
421 |
| KEGG |
|
| MeSH |
Carbon+monoxide |
|
|
| Nomor RTECS |
{{{value}}} |
| UNII |
|
| Nomor UN |
1016 |
InChI=1S/CO/c1-2 YKey: UGFAIRIUMAVXCW-UHFFFAOYSA-N YInChI=1/CO/c1-2 Key: UGFAIRIUMAVXCW-UHFFFAOYAT
|
|
| Sifat |
|
CO |
| Massa molar |
28.010 g/mol |
| Penampilan |
colorless gas |
| Bau |
odorless |
| Densitas |
789 kg/m3, liquid 1.250 kg/m3 at 0 °C, 1 atm 1.145 kg/m3 at 25 °C, 1 atm |
| Titik lebur |
−20.502 °C (−36.872 °F; −20.229 K) |
| Titik didih |
−1.915 °C (−3.415 °F; −1.642 K) |
|
27.6 mg/1 L (25 °C) |
| Kelarutan |
soluble in chloroform, acetic acid, ethyl acetate, ethanol, ammonium hydroxide, benzene |
| kH |
1.04 atm-m3/mol |
| Indeks bias (nD) |
1.0003364 |
|
0.122 D |
| Termokimia |
| Kapasitas kalor (C) |
29.1 J/K mol |
Entropi molar standar (So) |
197.7 J·mol−1·K−1 |
Entalpi pembentukan standar (ΔfHo) |
−110.5 kJ·mol−1 |
Entalpi pembakaran standar ΔcHo298 |
−283.4 kJ/mol |
| Bahaya |
| Lembar data keselamatan |
ICSC 0023 |
|
F T+ |
| Frasa-R |
R61 R12 R26 R48/23 |
| Frasa-S |
S53 S45 |
| Titik nyala |
−191 °C (−311,8 °F; 82,1 K) |
|
609 °C (1.128 °F; 882 K) |
| Ambang ledakan |
12.5–74.2% |
| Senyawa terkait |
Related carbon oxides |
Carbon dioxide Carbon suboxide Oxocarbons |
|
Y verifikasi (apa ini Y N ?) |
| Referensi |
|
|
Tracking categories (test):
Chembox/doc/images
 |
Ball-and-stick model of carbon monoxide |
Spacefill model of carbon monoxide |
|
| Nama |
| Nama IUPAC (preferensi)
|
| Nama lain
Carbon monooxide Carbonous oxide Carbon(II) oxide Carbonyl |
| Penanda |
|
|
|
|
| Referensi Beilstein |
3587264 |
| ChEBI |
|
| ChemSpider |
|
| Nomor EC |
|
| Referensi Gmelin |
421 |
| KEGG |
|
| MeSH |
Carbon+monoxide |
|
|
| Nomor RTECS |
{{{value}}} |
| UNII |
|
| Nomor UN |
1016 |
InChI=1S/CO/c1-2 YKey: UGFAIRIUMAVXCW-UHFFFAOYSA-N YInChI=1/CO/c1-2 Key: UGFAIRIUMAVXCW-UHFFFAOYAT
|
|
| Sifat |
|
CO |
| Massa molar |
28.010 g/mol |
| Penampilan |
colorless gas |
| Bau |
odorless |
| Densitas |
789 kg/m3, liquid 1.250 kg/m3 at 0 °C, 1 atm 1.145 kg/m3 at 25 °C, 1 atm |
| Titik lebur |
−20.502 °C (−36.872 °F; −20.229 K) |
| Titik didih |
−1.915 °C (−3.415 °F; −1.642 K) |
|
27.6 mg/1 L (25 °C) |
| Kelarutan |
soluble in chloroform, acetic acid, ethyl acetate, ethanol, ammonium hydroxide, benzene |
| kH |
1.04 atm-m3/mol |
| Indeks bias (nD) |
1.0003364 |
|
0.122 D |
| Termokimia |
| Kapasitas kalor (C) |
29.1 J/K mol |
Entropi molar standar (So) |
197.7 J·mol−1·K−1 |
Entalpi pembentukan standar (ΔfHo) |
−110.5 kJ·mol−1 |
Entalpi pembakaran standar ΔcHo298 |
−283.4 kJ/mol |
| Bahaya |
| Lembar data keselamatan |
ICSC 0023 |
|
F T+ |
| Frasa-R |
R61 R12 R26 R48/23 |
| Frasa-S |
S53 S45 |
| Titik nyala |
−191 °C (−311,8 °F; 82,1 K) |
|
609 °C (1.128 °F; 882 K) |
| Ambang ledakan |
12.5–74.2% |
| Senyawa terkait |
Related carbon oxides |
Carbon dioxide Carbon suboxide Oxocarbons |
|
Y verifikasi (apa ini Y N ?) |
| Referensi |
|
|
Tracking categories (test):
live
Chembox/doc/images
 |
Ball-and-stick model of carbon monoxide |
Spacefill model of carbon monoxide |
|
| Nama |
| Nama IUPAC (preferensi)
|
| Nama lain
Carbon monooxide Carbonous oxide Carbon(II) oxide Carbonyl |
| Penanda |
|
|
|
|
| Referensi Beilstein |
3587264 |
| ChEBI |
|
| ChemSpider |
|
| Nomor EC |
|
| Referensi Gmelin |
421 |
| KEGG |
|
| MeSH |
Carbon+monoxide |
|
|
| Nomor RTECS |
{{{value}}} |
| UNII |
|
| Nomor UN |
1016 |
InChI=1S/CO/c1-2 YKey: UGFAIRIUMAVXCW-UHFFFAOYSA-N YInChI=1/CO/c1-2 Key: UGFAIRIUMAVXCW-UHFFFAOYAT
|
|
| Sifat |
|
CO |
| Massa molar |
28.010 g/mol |
| Penampilan |
colorless gas |
| Bau |
odorless |
| Densitas |
789 kg/m3, liquid 1.250 kg/m3 at 0 °C, 1 atm 1.145 kg/m3 at 25 °C, 1 atm |
| Titik lebur |
−20.502 °C (−36.872 °F; −20.229 K) |
| Titik didih |
−1.915 °C (−3.415 °F; −1.642 K) |
|
27.6 mg/1 L (25 °C) |
| Kelarutan |
soluble in chloroform, acetic acid, ethyl acetate, ethanol, ammonium hydroxide, benzene |
| kH |
1.04 atm-m3/mol |
| Indeks bias (nD) |
1.0003364 |
|
0.122 D |
| Termokimia |
| Kapasitas kalor (C) |
29.1 J/K mol |
Entropi molar standar (So) |
197.7 J·mol−1·K−1 |
Entalpi pembentukan standar (ΔfHo) |
−110.5 kJ·mol−1 |
Entalpi pembakaran standar ΔcHo298 |
−283.4 kJ/mol |
| Bahaya |
| Lembar data keselamatan |
ICSC 0023 |
|
F T+ |
| Frasa-R |
R61 R12 R26 R48/23 |
| Frasa-S |
S53 S45 |
| Titik nyala |
−191 °C (−311,8 °F; 82,1 K) |
|
609 °C (1.128 °F; 882 K) |
| Ambang ledakan |
12.5–74.2% |
| Senyawa terkait |
Related carbon oxides |
Carbon dioxide Carbon suboxide Oxocarbons |
|
Y verifikasi (apa ini Y N ?) |
| Referensi |
|
|
Tracking categories (test):
Example
Code from an existing example
ImageFilen
 ImageFile<blank> |
 1 |
NameHere L1L1 |
NameHere R1R1 |
|
 2 |
 L2 |
 R2 |
|
 3 |
 L3 |
 R3 |
|
|
| Referensi |
|
|
Referensi
ImageFilen
 ImageFile<blank> |
 1 |
 L1 |
 R1 |
|
 2 |
 L2 |
 R2 |
|
 3 (local enwiki) |
 L3 |
 R3 |
|
|
| Referensi |
|
|
Referensi
Daftar referensi akan muncul dalam artikel utama.